|
Detail produk:
|
| Nama Produk: | Asam erithorbic | KAS: | 89-65-6 |
|---|---|---|---|
| EINECS: | 202-293-2 | Titik lebur: | 169-172 °C (des.) (lit.) |
| Suhu penyimpanan: | 2-8°C | Membentuk: | Kristal atau Bubuk Kristal |
| Warna: | Putih hingga agak kuning | ||
| Menyoroti: | Erythorbic Acid biochemical reagent,CAS89-65-6 lab chemical,Erythorbic Acid for laboratories |
||
| Product Name: | Erythorbic Acid |
| Synonyms: | 2,3-didehydro-d-erythro-hexono-1,4-lactone;FEMA 2410;ISOASCORBIC ACID;ISOVITAMIN C;3-keto-d-erythro-hexonicacigamma-lactone;araboascorbicacid;d-arabino-ascorbicacid;d-erythro-3-ketohexonicacidlactone |
| CAS: | 89-65-6 |
| MF: | C6H8O6 |
| MW: | 176.12 |
| EINECS: | 201-928-0 |
| Product Categories: | Food additive;Water Ttreatment Chemicals;Sugar Acids;Vitamin Derivatives;Biochemistry;Sugars;Vitamins;Food and Feed Additive;89-65-6 |
| Mol File: | 89-65-6.mol |
| Erythorbic Acid Chemical Properties |
| Melting point | 169-172 °C (dec.) (lit.) |
| alpha | -17.25 º (c=10, H2O 25 ºC) |
| Boiling point | 227.71°C (rough estimate) |
| density | 1.3744 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | -17.5 ° (C=10, H2O) |
| FEMA | 2410 | ERYTHROBIC ACID |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless to very faintly yellow |
| pka | 4.09±0.10(Predicted) |
| form | Crystals or Crystalline Powder |
| color | White to slightly yellow |
| Odor | odorless |
| Optical Rotation | [α]25/D 16.8°, c = 2 in H2O |
| biological source | (Starch) |
| Water Solubility | 1g/10mL |
| Merck | 14,5126 |
| BRN | 84271 |
| Stability: | Stable. Combustible. Incompatible with chemically active metals, aluminium, zinc, copper, magnesium, strong bases, strong oxidizing agents. |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| Cosmetic Ingredient Review (CIR) | Erythorbic Acid (89-65-6) |
| InChI | 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5-/m1/s1 |
| InChIKey | CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
| SMILES | [H][C@@]1(OC(=O)C(O)=C1O)[C@H](O)CO |
| LogP | -1.69 at 25℃ |
| CAS DataBase Reference | 89-65-6(CAS DataBase Reference) |
| EPA Substance Registry System | Isoascorbic acid (89-65-6) |
|
|
Kontak Person: Maggie Ma
Tel: +0086 188 7414 9531